Compound Q&A

What industries use Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate (CAS: 40361-79-3)?

Answer

Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate
Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate is primarily used in the pharmaceutical and chemical industries. It serves as an intermediate in the synthesis of various drugs and as a reagent in organic chemistry. Its use in polymer and semiconductor industries is also reported, particularly in the preparation of functional materials and in the development of new chemical sensors.

About

CAS No 40361-79-3
English Name Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate
Molecular Formula C6H7N3O4
Molecular Weight 185.14 g/mol
SMILES O=C(C1=CN=C([N+]([O-])=O)N1C)OC
InChIKey BQTWOZOPNUFRHG-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate (CAS: 40361-79-3)?

Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate is a white crystalline solid with a molecular wei...

Compound Q&A

How is Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate (CAS: 40361-79-3) typically synthesized?

Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate is typically synthesized via the reaction of meth...

Compound Q&A

What precautions should be taken when handling Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate (CAS: 40361-79-3)?

When handling Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate, it is essential to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...