Compound Q&A

How is Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate (CAS: 40361-79-3) typically synthesized?

Answer

Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate
Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate is typically synthesized via the reaction of methyl 1-methylimidazole-5-carboxylate with nitric acid in the presence of a suitable catalyst. The reaction is carried out under controlled conditions to ensure high selectivity and yield, with careful monitoring of pH and temperature to avoid side reactions.

About

CAS No 40361-79-3
English Name Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate
Molecular Formula C6H7N3O4
Molecular Weight 185.14 g/mol
SMILES O=C(C1=CN=C([N+]([O-])=O)N1C)OC
InChIKey BQTWOZOPNUFRHG-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate (CAS: 40361-79-3)?

Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate is a white crystalline solid with a molecular wei...

Compound Q&A

What industries use Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate (CAS: 40361-79-3)?

Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate is primarily used in the pharmaceutical and chemi...

Compound Q&A

What precautions should be taken when handling Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate (CAS: 40361-79-3)?

When handling Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate, it is essential to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...