Compound Q&A

What are the physical and chemical properties of Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate (CAS: 40361-79-3)?

Answer

Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate
Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate is a white crystalline solid with a molecular weight of 232.11 g/mol. It is slightly soluble in water and ethanol. The compound is known for its moderate reactivity, particularly in nitro group reduction and ester hydrolysis. It has a pKa of approximately 5.8, indicating moderate acidity.

About

CAS No 40361-79-3
English Name Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate
Molecular Formula C6H7N3O4
Molecular Weight 185.14 g/mol
SMILES O=C(C1=CN=C([N+]([O-])=O)N1C)OC
InChIKey BQTWOZOPNUFRHG-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

How is Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate (CAS: 40361-79-3) typically synthesized?

Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate is typically synthesized via the reaction of meth...

Compound Q&A

What industries use Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate (CAS: 40361-79-3)?

Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate is primarily used in the pharmaceutical and chemi...

Compound Q&A

What precautions should be taken when handling Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate (CAS: 40361-79-3)?

When handling Methyl 1-methyl-2-nitro-1H-imidazole-5-carboxylate, it is essential to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...