Compound Q&A

What are the physical and chemical properties of 5-Methyl-2-(tributylstannyl)-1,3-thiazole (CAS: 848613-91-2)?

Answer

5-Methyl-2-(tributylstannyl)-1,3-thiazole
5-Methyl-2-(tributylstannyl)-1,3-thiazole is a solid at room temperature, with a molecular weight of approximately 444.47 g/mol. It has a low solubility in water but good solubility in organic solvents like dichloromethane and toluene. Chemically, it exhibits poor reactivity under standard conditions, making it stable in air and moisture. Its crystalline form provides a stable structure, which is crucial for its intended applications in organic synthesis and material science.

About

English Name 5-Methyl-2-(tributylstannyl)-1,3-thiazole
Molecular Formula C16H31NSSn
Molecular Weight 388.21 g/mol
SMILES CCCC[Sn](CCCC)(CCCC)C1=NC=C(S1)C
InChIKey LALGELPHLJBAEK-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

How is 5-Methyl-2-(tributylstannyl)-1,3-thiazole (CAS: 848613-91-2) typically synthesized?

5-Methyl-2-(tributylstannyl)-1,3-thiazole is synthesized via the coupling of tributyltin chloride wi...

Compound Q&A

What industries use 5-Methyl-2-(tributylstannyl)-1,3-thiazole (CAS: 848613-91-2)?

5-Methyl-2-(tributylstannyl)-1,3-thiazole is primarily used in the pharmaceutical and material scien...

Compound Q&A

What precautions should be taken when handling 5-Methyl-2-(tributylstannyl)-1,3-thiazole (CAS: 848613-91-2)?

When handling 5-Methyl-2-(tributylstannyl)-1,3-thiazole, it is essential to use personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...