Compound Q&A

What precautions should be taken when handling Amyloid beta-Protein (1-28) (CAS: 109770-29-8)?

Answer

Amyloid beta-Protein (1-28)
When handling Amyloid beta-Protein (1-28), it is crucial to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate methodologies, and an SDS (Safety Data Sheet) should be consulted for detailed handling and disposal procedures.

About

English Name Amyloid beta-Protein (1-28)
Molecular Formula C145H209N41O46
Molecular Weight 3262.5 g/mol
SMILES CC(C)CC(C(=O)NC(C(C)C)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CC2=CC=CC=C2)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(C(C)C)C(=O)NCC(=O)NC(CO)C(=O)NC(CC(=O)N)C(=O)NC(CCCCN)C(=O)O)NC(=O)C(CCCCN)NC(=O)C(CCC(=O)N)NC(=O)C(CC3=CNC=N3)NC(=O)C(CC4=CNC=N4)NC(=O)C(C(C)C)NC(=O)C(CCC(=O)O)NC(=O)C(CC5=CC=C(C=C5)O)NC(=O)CNC(=O)C(CO)NC(=O)C(CC(=O)O)NC(=O)C(CC6=CNC=N6)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC7=CC=CC=C7)NC(=O)C(CCC(=O)O)NC(=O)C(C)NC(=O)C(CC(=O)O)N
InChIKey CMKVKXQGLWBAFY-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Amyloid beta-Protein (1-28) (CAS: 109770-29-8)?

Amyloid beta-Protein (1-28) is a peptide with a molecular weight of approximately 3,261.28 g/mol. It...

Compound Q&A

How is Amyloid beta-Protein (1-28) (CAS: 109770-29-8) typically synthesized?

Amyloid beta-Protein (1-28) is typically synthesized using solid-phase peptide synthesis (SPPS). The...

Compound Q&A

What industries use Amyloid beta-Protein (1-28) (CAS: 109770-29-8)?

Amyloid beta-Protein (1-28) is primarily used in the pharmaceutical industry for research into Alzhe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...