Compound Q&A

How is Amyloid beta-Protein (1-28) (CAS: 109770-29-8) typically synthesized?

Answer

Amyloid beta-Protein (1-28)
Amyloid beta-Protein (1-28) is typically synthesized using solid-phase peptide synthesis (SPPS). The process involves the stepwise addition of amino acids to a growing peptide chain on a solid support, followed by cleavage from the support and purification. Commonly used protecting groups include FMOC and Boc, with high yield and good purity after purification steps.

About

English Name Amyloid beta-Protein (1-28)
Molecular Formula C145H209N41O46
Molecular Weight 3262.5 g/mol
SMILES CC(C)CC(C(=O)NC(C(C)C)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CC2=CC=CC=C2)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(C(C)C)C(=O)NCC(=O)NC(CO)C(=O)NC(CC(=O)N)C(=O)NC(CCCCN)C(=O)O)NC(=O)C(CCCCN)NC(=O)C(CCC(=O)N)NC(=O)C(CC3=CNC=N3)NC(=O)C(CC4=CNC=N4)NC(=O)C(C(C)C)NC(=O)C(CCC(=O)O)NC(=O)C(CC5=CC=C(C=C5)O)NC(=O)CNC(=O)C(CO)NC(=O)C(CC(=O)O)NC(=O)C(CC6=CNC=N6)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC7=CC=CC=C7)NC(=O)C(CCC(=O)O)NC(=O)C(C)NC(=O)C(CC(=O)O)N
InChIKey CMKVKXQGLWBAFY-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of Amyloid beta-Protein (1-28) (CAS: 109770-29-8)?

Amyloid beta-Protein (1-28) is a peptide with a molecular weight of approximately 3,261.28 g/mol. It...

Compound Q&A

What industries use Amyloid beta-Protein (1-28) (CAS: 109770-29-8)?

Amyloid beta-Protein (1-28) is primarily used in the pharmaceutical industry for research into Alzhe...

Compound Q&A

What precautions should be taken when handling Amyloid beta-Protein (1-28) (CAS: 109770-29-8)?

When handling Amyloid beta-Protein (1-28), it is crucial to use personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...