Compound Q&A

What industries use Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate (CAS: 885270-54-2)?

Answer

Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate
Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various bioactive compounds. It also finds applications in the polymer industry for the development of functional polymers and in the sensor industry for the production of gas sensors.

About

English Name Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate
Molecular Formula C14H20N2O2
Molecular Weight 248.33 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC2=C(CCNC2)C=C1
InChIKey VTTOWYHROSNYPM-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate (CAS: 885270-54-2)?

Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate is a white crystalline solid with a molecular...

Compound Q&A

How is Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate (CAS: 885270-54-2) typically synthesized?

Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate is typically synthesized via a multi-step pro...

Compound Q&A

What precautions should be taken when handling Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate (CAS: 885270-54-2)?

When handling Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...