Compound Q&A

What are the physical and chemical properties of Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate (CAS: 885270-54-2)?

Answer

Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate
Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate is a white crystalline solid with a molecular weight of approximately 315.46 g/mol. It has low water solubility but is more soluble in organic solvents such as dimethylformamide (DMF) and dimethylsulfoxide (DMSO). The compound is moderately reactive, particularly towards nucleophiles and bases, making it prone to deamination under basic conditions.

About

English Name Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate
Molecular Formula C14H20N2O2
Molecular Weight 248.33 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC2=C(CCNC2)C=C1
InChIKey VTTOWYHROSNYPM-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate (CAS: 885270-54-2) typically synthesized?

Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate is typically synthesized via a multi-step pro...

Compound Q&A

What industries use Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate (CAS: 885270-54-2)?

Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate (CAS: 885270-54-2)?

When handling Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...