Compound Q&A

How is Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate (CAS: 885270-54-2) typically synthesized?

Answer

Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate
Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate is typically synthesized via a multi-step process involving the condensation of tert-butyl isonicotinate with 1,2,3,4-tetrahydroisoquinoline under basic conditions. The reaction is catalyzed by an appropriate base such as triethylamine. The yield is generally around 70%, and the product is isolated by recrystallization from solvents like DMF.

About

English Name Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate
Molecular Formula C14H20N2O2
Molecular Weight 248.33 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC2=C(CCNC2)C=C1
InChIKey VTTOWYHROSNYPM-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate (CAS: 885270-54-2)?

Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate is a white crystalline solid with a molecular...

Compound Q&A

What industries use Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate (CAS: 885270-54-2)?

Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate (CAS: 885270-54-2)?

When handling Tert-butyl 1,2,3,4-tetrahydroisoquinolin-7-ylcarbamate, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...