Compound Q&A

What industries use (R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1)?

Answer

(?)-Bis[(S)-1-phenylethyl]amine
(R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1) is primarily used in the pharmaceutical industry as a chiral intermediate for the synthesis of various drugs. It is also utilized in the development of sensors and semiconductors due to its unique optical and electronic properties. Additionally, it finds applications in polymer science for the synthesis of specific types of polymers.

About

CAS No 56210-72-1
English Name (?)-Bis[(S)-1-phenylethyl]amine
Molecular Formula C16H19N
Molecular Weight 225.33 g/mol
SMILES CC(C1=CC=CC=C1)NC(C)C2=CC=CC=C2
InChIKey NXLACVVNHYIYJN-KBPBESRZSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1)?

(R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1) is a crystalline amine with a molecular weight of ...

Compound Q&A

How is (R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1) typically synthesized?

(R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1) can be synthesized via a multistep process involvi...

Compound Q&A

What precautions should be taken when handling (R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1)?

When handling (R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1), it is crucial to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...