Compound Q&A

What are the physical and chemical properties of (R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1)?

Answer

(?)-Bis[(S)-1-phenylethyl]amine
(R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1) is a crystalline amine with a molecular weight of approximately 265.36 g/mol. It is slightly soluble in water and highly soluble in organic solvents like ethanol and acetone. The compound is known for its reactivity towards nucleophiles and can undergo substitution reactions. It has a boiling point of about 165°C and a melting point of 76-78°C.

About

CAS No 56210-72-1
English Name (?)-Bis[(S)-1-phenylethyl]amine
Molecular Formula C16H19N
Molecular Weight 225.33 g/mol
SMILES CC(C1=CC=CC=C1)NC(C)C2=CC=CC=C2
InChIKey NXLACVVNHYIYJN-KBPBESRZSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is (R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1) typically synthesized?

(R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1) can be synthesized via a multistep process involvi...

Compound Q&A

What industries use (R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1)?

(R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1) is primarily used in the pharmaceutical industry a...

Compound Q&A

What precautions should be taken when handling (R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1)?

When handling (R)-Bis[(S)-1-phenylethyl]amine (CAS: 56210-72-1), it is crucial to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...