Compound Q&A

What industries use 2,5,6-Trichloronicotinamide (CAS: 142266-62-4)?

Answer

2,5,6-Trichloronicotinamide
2,5,6-Trichloronicotinamide is used primarily in the pharmaceutical industry for the synthesis of various drugs. It also finds applications in the chemical industry for the production of dyes and other organic compounds. Additionally, it is used in the field of analytical chemistry as a reagent for certain spectroscopic techniques and in the preparation of certain sensors.

About

English Name 2,5,6-Trichloronicotinamide
Molecular Formula C6H3Cl3N2O
Molecular Weight 225.46 g/mol
SMILES c1c(c(nc(c1Cl)Cl)Cl)C(=O)N
InChIKey DBAVDGXPOXFHRC-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5,6-Trichloronicotinamide (CAS: 142266-62-4)?

2,5,6-Trichloronicotinamide is a white crystalline solid with a molecular weight of approximately 20...

Compound Q&A

How is 2,5,6-Trichloronicotinamide (CAS: 142266-62-4) typically synthesized?

2,5,6-Trichloronicotinamide is typically synthesized via the condensation of chlorobenzoyl chloride ...

Compound Q&A

What precautions should be taken when handling 2,5,6-Trichloronicotinamide (CAS: 142266-62-4)?

When handling 2,5,6-Trichloronicotinamide, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...