Compound Q&A

How is 2,5,6-Trichloronicotinamide (CAS: 142266-62-4) typically synthesized?

Answer

2,5,6-Trichloronicotinamide
2,5,6-Trichloronicotinamide is typically synthesized via the condensation of chlorobenzoyl chloride with hydrazine hydrate followed by heating. The reaction is catalyzed by a Lewis acid such as aluminum chloride. This method provides a yield of around 70-80%, with good selectivity towards the desired product. The process is conducted under an inert atmosphere to avoid side reactions.

About

English Name 2,5,6-Trichloronicotinamide
Molecular Formula C6H3Cl3N2O
Molecular Weight 225.46 g/mol
SMILES c1c(c(nc(c1Cl)Cl)Cl)C(=O)N
InChIKey DBAVDGXPOXFHRC-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5,6-Trichloronicotinamide (CAS: 142266-62-4)?

2,5,6-Trichloronicotinamide is a white crystalline solid with a molecular weight of approximately 20...

Compound Q&A

What industries use 2,5,6-Trichloronicotinamide (CAS: 142266-62-4)?

2,5,6-Trichloronicotinamide is used primarily in the pharmaceutical industry for the synthesis of va...

Compound Q&A

What precautions should be taken when handling 2,5,6-Trichloronicotinamide (CAS: 142266-62-4)?

When handling 2,5,6-Trichloronicotinamide, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...