Compound Q&A

What are the physical and chemical properties of 2,5,6-Trichloronicotinamide (CAS: 142266-62-4)?

Answer

2,5,6-Trichloronicotinamide
2,5,6-Trichloronicotinamide is a white crystalline solid with a molecular weight of approximately 205.03 g/mol. It has a low solubility in water (0.2 g/L at 20°C) and good solubility in organic solvents such as ethanol and acetone. It shows moderate reactivity towards nucleophiles, making it useful in various synthetic applications. The compound is stable under normal conditions but should be stored in a well-ventilated area to avoid inhalation exposure.

About

English Name 2,5,6-Trichloronicotinamide
Molecular Formula C6H3Cl3N2O
Molecular Weight 225.46 g/mol
SMILES c1c(c(nc(c1Cl)Cl)Cl)C(=O)N
InChIKey DBAVDGXPOXFHRC-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is 2,5,6-Trichloronicotinamide (CAS: 142266-62-4) typically synthesized?

2,5,6-Trichloronicotinamide is typically synthesized via the condensation of chlorobenzoyl chloride ...

Compound Q&A

What industries use 2,5,6-Trichloronicotinamide (CAS: 142266-62-4)?

2,5,6-Trichloronicotinamide is used primarily in the pharmaceutical industry for the synthesis of va...

Compound Q&A

What precautions should be taken when handling 2,5,6-Trichloronicotinamide (CAS: 142266-62-4)?

When handling 2,5,6-Trichloronicotinamide, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...