Compound Q&A

What industries use (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS: 791582-16-6)?

Answer

(3R)-3-Amino-3-[2-(trifluoromethyl)phenyl]propanoic acid
(3R)-3-Amino-3-[2-(trifluoromethyl)phenyl]propanoic acid is used in the pharmaceutical industry for the synthesis of drug intermediates. It is also utilized in the polymer industry for the development of advanced polymers with enhanced properties. Additionally, it has applications in the sensor and semiconductor industries due to its unique chemical structure.

About

English Name (3R)-3-Amino-3-[2-(trifluoromethyl)phenyl]propanoic acid
Molecular Formula C10H10F3NO2
Molecular Weight 233.19 g/mol
SMILES C1=CC=C(C(=C1)C(CC(=O)O)N)C(F)(F)F
InChIKey MXKROQQTKYAUJB-MRVPVSSYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS: 791582-16-6)?

(3R)-3-Amino-3-[2-(trifluoromethyl)phenyl]propanoic acid is a white crystalline solid with a molecul...

Compound Q&A

How is (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS: 791582-16-6) typically synthesized?

The compound is typically synthesized through multi-step reactions involving the protection of a car...

Compound Q&A

What precautions should be taken when handling (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS: 791582-16-6)?

When handling (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid, proper personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...