Compound Q&A

What are the physical and chemical properties of (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS: 791582-16-6)?

Answer

(3R)-3-Amino-3-[2-(trifluoromethyl)phenyl]propanoic acid
(3R)-3-Amino-3-[2-(trifluoromethyl)phenyl]propanoic acid is a white crystalline solid with a molecular weight of approximately 286.08 g/mol. It is slightly soluble in water but more soluble in polar solvents like ethanol. This compound is moderately reactive, particularly with basic substances. It has a high boiling point and is stable under normal laboratory conditions.

About

English Name (3R)-3-Amino-3-[2-(trifluoromethyl)phenyl]propanoic acid
Molecular Formula C10H10F3NO2
Molecular Weight 233.19 g/mol
SMILES C1=CC=C(C(=C1)C(CC(=O)O)N)C(F)(F)F
InChIKey MXKROQQTKYAUJB-MRVPVSSYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS: 791582-16-6) typically synthesized?

The compound is typically synthesized through multi-step reactions involving the protection of a car...

Compound Q&A

What industries use (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS: 791582-16-6)?

(3R)-3-Amino-3-[2-(trifluoromethyl)phenyl]propanoic acid is used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS: 791582-16-6)?

When handling (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid, proper personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...