Compound Q&A

How is (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS: 791582-16-6) typically synthesized?

Answer

(3R)-3-Amino-3-[2-(trifluoromethyl)phenyl]propanoic acid
The compound is typically synthesized through multi-step reactions involving the protection of a carboxylic acid, introduction of the trifluoromethyl group, and subsequent deprotection. Common synthetic methods include the use of protected precursors, protecting groups, and catalysts to achieve high selectivity and yield. The exact method may vary depending on the specific starting materials and desired purity.

About

English Name (3R)-3-Amino-3-[2-(trifluoromethyl)phenyl]propanoic acid
Molecular Formula C10H10F3NO2
Molecular Weight 233.19 g/mol
SMILES C1=CC=C(C(=C1)C(CC(=O)O)N)C(F)(F)F
InChIKey MXKROQQTKYAUJB-MRVPVSSYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS: 791582-16-6)?

(3R)-3-Amino-3-[2-(trifluoromethyl)phenyl]propanoic acid is a white crystalline solid with a molecul...

Compound Q&A

What industries use (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS: 791582-16-6)?

(3R)-3-Amino-3-[2-(trifluoromethyl)phenyl]propanoic acid is used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS: 791582-16-6)?

When handling (3R)-3-amino-3-[2-(trifluoromethyl)phenyl]propanoic acid, proper personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...