Compound Q&A

What industries use 3-Amino-N-isopropylbenzenesulfonamide (CAS: 118837-66-4)?

Answer

3-Amino-N-isopropylbenzenesulfonamide
3-Amino-N-isopropylbenzenesulfonamide (CAS: 118837-66-4) finds applications in the pharmaceutical industry, where it can be used as an intermediate in the synthesis of various drugs. It is also utilized in the polymer industry for the modification of materials, and in the development of sensors due to its unique chemical properties. Additionally, it can be used in the semiconductor industry for specific applications in material science and electronics.

About

English Name 3-Amino-N-isopropylbenzenesulfonamide
Molecular Formula C9H14N2O2S
Molecular Weight 214.29 g/mol
SMILES CC(C)NS(=O)(=O)C1=CC=CC(=C1)N
InChIKey NIUZLEBXTLRCKA-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-N-isopropylbenzenesulfonamide (CAS: 118837-66-4)?

3-Amino-N-isopropylbenzenesulfonamide is a crystalline compound with a molecular weight of approxima...

Compound Q&A

How is 3-Amino-N-isopropylbenzenesulfonamide (CAS: 118837-66-4) typically synthesized?

3-Amino-N-isopropylbenzenesulfonamide can be synthesized through a multi-step process. The initial s...

Compound Q&A

What precautions should be taken when handling 3-Amino-N-isopropylbenzenesulfonamide (CAS: 118837-66-4)?

When handling 3-Amino-N-isopropylbenzenesulfonamide, it is important to wear protective equipment su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...