Compound Q&A

What industries use 5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5)?

Answer

5-Bromo-8-chloro-1,7-naphthyridine
5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5) is primarily used in the pharmaceutical industry for the development of novel drugs. It also finds applications in the synthesis of chromophores for sensors and in the production of certain organic semiconductors. Additionally, it can be used in polymer chemistry for the modification of polymer properties.

About

English Name 5-Bromo-8-chloro-1,7-naphthyridine
Molecular Formula C8H4BrClN2
Molecular Weight 243.49099999999999 g/mol
SMILES C1=CC2=C(C(=NC=C2Br)Cl)N=C1
InChIKey GEVCHQPTJOFDSA-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5)?

5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5) is a solid compound with a crystalline form. I...

Compound Q&A

How is 5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5) typically synthesized?

5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5) can be synthesized by a multistep process invo...

Compound Q&A

What precautions should be taken when handling 5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5)?

When handling 5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5), appropriate personal protective...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...