Compound Q&A

What are the physical and chemical properties of 5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5)?

Answer

5-Bromo-8-chloro-1,7-naphthyridine
5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5) is a solid compound with a crystalline form. Its molecular weight is approximately 266.03 g/mol. It has low solubility in water but is more soluble in organic solvents like ethanol and acetonitrile. This compound is known for its moderate reactivity, particularly towards nucleophiles and electrophiles, and it can undergo substitution reactions under various conditions.

About

English Name 5-Bromo-8-chloro-1,7-naphthyridine
Molecular Formula C8H4BrClN2
Molecular Weight 243.49099999999999 g/mol
SMILES C1=CC2=C(C(=NC=C2Br)Cl)N=C1
InChIKey GEVCHQPTJOFDSA-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is 5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5) typically synthesized?

5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5) can be synthesized by a multistep process invo...

Compound Q&A

What industries use 5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5)?

5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5)?

When handling 5-Bromo-8-chloro-1,7-naphthyridine (CAS: 909649-06-5), appropriate personal protective...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...