Compound Q&A

What industries use Methyl 2,5-dibromonicotinate (CAS: 78686-82-5)?

Answer

Methyl 2,5-dibromonicotinate
Methyl 2,5-dibromonicotinate (CAS: 78686-82-5) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It also finds application in the production of functionalized organic compounds for use in sensors and semiconductors. Its reactivity towards electrophiles makes it useful in these sectors for creating specific chemical functionalities.

About

CAS No 78686-82-5
English Name Methyl 2,5-dibromonicotinate
Molecular Formula C7H5Br2NO2
Molecular Weight 294.93 g/mol
SMILES COC(=O)C1=C(N=CC(=C1)Br)Br
InChIKey PHGNHPIJCKMPTI-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,5-dibromonicotinate (CAS: 78686-82-5)?

Methyl 2,5-dibromonicotinate (CAS: 78686-82-5) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is Methyl 2,5-dibromonicotinate (CAS: 78686-82-5) typically synthesized?

Methyl 2,5-dibromonicotinate (CAS: 78686-82-5) is typically synthesized by the bromination of methyl...

Compound Q&A

What precautions should be taken when handling Methyl 2,5-dibromonicotinate (CAS: 78686-82-5)?

Handling Methyl 2,5-dibromonicotinate (CAS: 78686-82-5) requires strict safety measures. Always wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...