Compound Q&A

What are the physical and chemical properties of Methyl 2,5-dibromonicotinate (CAS: 78686-82-5)?

Answer

Methyl 2,5-dibromonicotinate
Methyl 2,5-dibromonicotinate (CAS: 78686-82-5) is a crystalline solid with a molecular weight of approximately 380.02 g/mol. It is sparingly soluble in water but dissolves easily in organic solvents like ethanol and acetone. This compound is highly reactive towards nucleophiles and electrophiles. It exhibits strong electrophilic bromine substituents which can undergo substitution reactions under various conditions.

About

CAS No 78686-82-5
English Name Methyl 2,5-dibromonicotinate
Molecular Formula C7H5Br2NO2
Molecular Weight 294.93 g/mol
SMILES COC(=O)C1=C(N=CC(=C1)Br)Br
InChIKey PHGNHPIJCKMPTI-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is Methyl 2,5-dibromonicotinate (CAS: 78686-82-5) typically synthesized?

Methyl 2,5-dibromonicotinate (CAS: 78686-82-5) is typically synthesized by the bromination of methyl...

Compound Q&A

What industries use Methyl 2,5-dibromonicotinate (CAS: 78686-82-5)?

Methyl 2,5-dibromonicotinate (CAS: 78686-82-5) is primarily used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling Methyl 2,5-dibromonicotinate (CAS: 78686-82-5)?

Handling Methyl 2,5-dibromonicotinate (CAS: 78686-82-5) requires strict safety measures. Always wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...