Compound Q&A

What industries use 2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1)?

Answer

2,8-Dimethyl-4(1H)-quinolinone
2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1) finds applications in pharmaceuticals for the synthesis of certain drugs, particularly those that require quinolinone rings. It is also used in the development of polymers due to its aromatic structure, and it can be employed in sensors for its ability to detect specific chemical species. Additionally, it has potential applications in semiconductors for creating specific electronic properties.

About

CAS No 15644-80-1
English Name 2,8-Dimethyl-4(1H)-quinolinone
Molecular Formula C11H11NO
Molecular Weight 173.21 g/mol
SMILES CC1=C2C(=CC=C1)C(=O)C=C(N2)C
InChIKey QUHJYDMHDWSZIP-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1)?

2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1) is a crystalline solid with a molecular weight of a...

Compound Q&A

How is 2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1) typically synthesized?

2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1) can be synthesized via a condensation reaction of 2...

Compound Q&A

What precautions should be taken when handling 2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1)?

When handling 2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1), it is crucial to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...