Compound Q&A

What are the physical and chemical properties of 2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1)?

Answer

2,8-Dimethyl-4(1H)-quinolinone
2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1) is a crystalline solid with a molecular weight of approximately 210.21 g/mol. It has a high melting point around 225°C and is slightly soluble in water but soluble in organic solvents like ethanol and acetonitrile. Chemically, it is stable in neutral and acidic conditions but can be sensitive to strong bases. It reacts with metal salts to form complexes and exhibits UV-Vis absorption in the visible region, useful for spectroscopic analysis.

About

CAS No 15644-80-1
English Name 2,8-Dimethyl-4(1H)-quinolinone
Molecular Formula C11H11NO
Molecular Weight 173.21 g/mol
SMILES CC1=C2C(=CC=C1)C(=O)C=C(N2)C
InChIKey QUHJYDMHDWSZIP-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is 2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1) typically synthesized?

2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1) can be synthesized via a condensation reaction of 2...

Compound Q&A

What industries use 2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1)?

2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1) finds applications in pharmaceuticals for the synth...

Compound Q&A

What precautions should be taken when handling 2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1)?

When handling 2,8-Dimethyl-4(1H)-quinolinone (CAS: 15644-80-1), it is crucial to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...