Compound Q&A

What industries use 1,5-Dibromo-2,4-dinitrobenzene (CAS: 24239-82-5)?

Answer

1,5-Dibromo-2,4-dinitrobenzene
1,5-Dibromo-2,4-dinitrobenzene is used in the pharmaceutical industry for the synthesis of certain drugs, and in the semiconductor industry for the production of organic semiconductors. It also has applications in the polymer industry for the synthesis of functional polymers and in the field of sensors for its unique reactivity.

About

CAS No 24239-82-5
English Name 1,5-Dibromo-2,4-dinitrobenzene
Molecular Formula C6H2Br2N2O4
Molecular Weight 325.9 g/mol
SMILES C1=C(C(=CC(=C1[N+](=O)[O-])Br)Br)[N+](=O)[O-]
InChIKey HYQUWYMJSAPGDY-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,5-Dibromo-2,4-dinitrobenzene (CAS: 24239-82-5)?

1,5-Dibromo-2,4-dinitrobenzene is a crystalline compound with a molecular weight of approximately 32...

Compound Q&A

How is 1,5-Dibromo-2,4-dinitrobenzene (CAS: 24239-82-5) typically synthesized?

1,5-Dibromo-2,4-dinitrobenzene is typically synthesized through the sequential bromination and nitra...

Compound Q&A

What precautions should be taken when handling 1,5-Dibromo-2,4-dinitrobenzene (CAS: 24239-82-5)?

When handling 1,5-Dibromo-2,4-dinitrobenzene, it is essential to wear proper personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...