Compound Q&A

What are the physical and chemical properties of 1,5-Dibromo-2,4-dinitrobenzene (CAS: 24239-82-5)?

Answer

1,5-Dibromo-2,4-dinitrobenzene
1,5-Dibromo-2,4-dinitrobenzene is a crystalline compound with a molecular weight of approximately 329.05 g/mol. It has a low solubility in water but is more soluble in organic solvents like acetone and methanol. The compound is known for its high reactivity, particularly towards nucleophiles. It exhibits strong absorption in the UV region, which can be used for spectroscopic analysis.

About

CAS No 24239-82-5
English Name 1,5-Dibromo-2,4-dinitrobenzene
Molecular Formula C6H2Br2N2O4
Molecular Weight 325.9 g/mol
SMILES C1=C(C(=CC(=C1[N+](=O)[O-])Br)Br)[N+](=O)[O-]
InChIKey HYQUWYMJSAPGDY-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is 1,5-Dibromo-2,4-dinitrobenzene (CAS: 24239-82-5) typically synthesized?

1,5-Dibromo-2,4-dinitrobenzene is typically synthesized through the sequential bromination and nitra...

Compound Q&A

What industries use 1,5-Dibromo-2,4-dinitrobenzene (CAS: 24239-82-5)?

1,5-Dibromo-2,4-dinitrobenzene is used in the pharmaceutical industry for the synthesis of certain d...

Compound Q&A

What precautions should be taken when handling 1,5-Dibromo-2,4-dinitrobenzene (CAS: 24239-82-5)?

When handling 1,5-Dibromo-2,4-dinitrobenzene, it is essential to wear proper personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...