Compound Q&A

How is 1,5-Dibromo-2,4-dinitrobenzene (CAS: 24239-82-5) typically synthesized?

Answer

1,5-Dibromo-2,4-dinitrobenzene
1,5-Dibromo-2,4-dinitrobenzene is typically synthesized through the sequential bromination and nitration of benzene. This involves first nitration of benzene to form 2,4-dinitrobenzene, followed by bromination of the meta position to yield 1,5-dibromo-2,4-dinitrobenzene. The reaction conditions include the use of concentrated sulfuric acid and fuming nitric acid for nitration, and bromine in carbon tetrachloride for bromination.

About

CAS No 24239-82-5
English Name 1,5-Dibromo-2,4-dinitrobenzene
Molecular Formula C6H2Br2N2O4
Molecular Weight 325.9 g/mol
SMILES C1=C(C(=CC(=C1[N+](=O)[O-])Br)Br)[N+](=O)[O-]
InChIKey HYQUWYMJSAPGDY-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,5-Dibromo-2,4-dinitrobenzene (CAS: 24239-82-5)?

1,5-Dibromo-2,4-dinitrobenzene is a crystalline compound with a molecular weight of approximately 32...

Compound Q&A

What industries use 1,5-Dibromo-2,4-dinitrobenzene (CAS: 24239-82-5)?

1,5-Dibromo-2,4-dinitrobenzene is used in the pharmaceutical industry for the synthesis of certain d...

Compound Q&A

What precautions should be taken when handling 1,5-Dibromo-2,4-dinitrobenzene (CAS: 24239-82-5)?

When handling 1,5-Dibromo-2,4-dinitrobenzene, it is essential to wear proper personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...