Compound Q&A

How is 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride (CAS: 193902-64-6) typically synthesized?

Answer

2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride (1:1)
2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride is typically synthesized by the condensation of 4-(4-aminophenyl)-1-piperazinecarboxylic acid with 2-methyl-2-propanol in the presence of a catalytic amount of 4-dimethylaminopyridine (DMAP). The reaction is carried out under mild conditions and proceeds with good yield and high selectivity.

About

English Name 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride (1:1)
Molecular Formula C15H24ClN3O2
Molecular Weight 313.83 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC1)C2=CC=C(C=C2)N.Cl.Cl
InChIKey LWBDYWNMRYIJNM-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride (CAS: 193902-64-6)?

2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride is a crystalline solid w...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride (CAS: 193902-64-6)?

2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride is primarily used in the...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride (CAS: 193902-64-6)?

When handling 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride, it is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...