Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride (CAS: 193902-64-6)?

Answer

2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride (1:1)
2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride is a crystalline solid with a molecular weight of approximately 381.85 g/mol. It has a solubility of about 100 mg/mL in water and is moderately soluble in organic solvents like methanol and ethanol. This compound is known for its reactivity in ester and amide formation, making it useful in organic synthesis and pharmaceutical applications.

About

English Name 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride (1:1)
Molecular Formula C15H24ClN3O2
Molecular Weight 313.83 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC1)C2=CC=C(C=C2)N.Cl.Cl
InChIKey LWBDYWNMRYIJNM-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride (CAS: 193902-64-6) typically synthesized?

2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride is typically synthesized...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride (CAS: 193902-64-6)?

2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride is primarily used in the...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride (CAS: 193902-64-6)?

When handling 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate hydrochloride, it is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...