Compound Q&A

What industries use Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate (CAS: 881909-58-6)?

Answer

Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate
Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate is primarily used in the pharmaceutical industry for the synthesis of complex organic compounds. It also finds applications in the polymer industry for the development of functional polymers and in the sensor industry for the creation of chemical sensors. Its use in semiconductors is limited but exists in specialized applications.

About

English Name Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate
Molecular Formula C15H14BrNO3
Molecular Weight 336.19 g/mol
SMILES COC(=O)C1=CC(=C(C(=C1)Br)N)OCC2=CC=CC=C2
InChIKey JUCFKDDNGJOJPC-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate (CAS: 881909-58-6)?

Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate is a crystalline compound with a molecular weight of ap...

Compound Q&A

How is Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate (CAS: 881909-58-6) typically synthesized?

Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate is synthesized through a multi-step process involving b...

Compound Q&A

What precautions should be taken when handling Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate (CAS: 881909-58-6)?

When handling Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate, proper personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...