Compound Q&A

How is Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate (CAS: 881909-58-6) typically synthesized?

Answer

Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate
Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate is synthesized through a multi-step process involving bromination and coupling reactions. Commonly, benzoic acid is brominated, followed by the coupling of the bromobenzoic acid with a benzyloxyamine compound. The reaction typically proceeds under basic conditions with a catalyst like triethylamine, yielding a high yield of the target compound.

About

English Name Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate
Molecular Formula C15H14BrNO3
Molecular Weight 336.19 g/mol
SMILES COC(=O)C1=CC(=C(C(=C1)Br)N)OCC2=CC=CC=C2
InChIKey JUCFKDDNGJOJPC-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate (CAS: 881909-58-6)?

Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate is a crystalline compound with a molecular weight of ap...

Compound Q&A

What industries use Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate (CAS: 881909-58-6)?

Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate (CAS: 881909-58-6)?

When handling Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate, proper personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...