Compound Q&A

What are the physical and chemical properties of Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate (CAS: 881909-58-6)?

Answer

Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate
Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate is a crystalline compound with a molecular weight of approximately 329.16 g/mol. It is soluble in organic solvents such as ethanol and acetone but has low solubility in water. The compound is moderately reactive, particularly towards nucleophiles, and undergoes substitution reactions. It is stable under normal conditions but should be stored away from direct sunlight and moisture.

About

English Name Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate
Molecular Formula C15H14BrNO3
Molecular Weight 336.19 g/mol
SMILES COC(=O)C1=CC(=C(C(=C1)Br)N)OCC2=CC=CC=C2
InChIKey JUCFKDDNGJOJPC-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate (CAS: 881909-58-6) typically synthesized?

Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate is synthesized through a multi-step process involving b...

Compound Q&A

What industries use Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate (CAS: 881909-58-6)?

Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate (CAS: 881909-58-6)?

When handling Methyl 4-amino-3-(benzyloxy)-5-bromobenzoate, proper personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...