Compound Q&A

What industries use 7-Chloro-4-quinolinecarboxylic acid (CAS: 13337-66-1)?

Answer

7-Chloro-4-quinolinecarboxylic acid
7-Chloro-4-quinolinecarboxylic acid finds applications in the pharmaceutical industry, where it is used as an intermediate in the synthesis of various drugs. It is also utilized in the polymer industry for the development of functional materials and in the sensor industry for the fabrication of gas sensors.

About

CAS No 13337-66-1
English Name 7-Chloro-4-quinolinecarboxylic acid
Molecular Formula C10H6ClNO2
Molecular Weight 207.62 g/mol
SMILES C1=CC2=C(C=CN=C2C=C1Cl)C(=O)O
InChIKey TXYVRYRRTQYTHJ-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Chloro-4-quinolinecarboxylic acid (CAS: 13337-66-1)?

7-Chloro-4-quinolinecarboxylic acid (CAS: 13337-66-1) is a crystalline solid with a molecular weight...

Compound Q&A

How is 7-Chloro-4-quinolinecarboxylic acid (CAS: 13337-66-1) typically synthesized?

7-Chloro-4-quinolinecarboxylic acid is typically synthesized by the chlorination of 4-quinolinecarbo...

Compound Q&A

What precautions should be taken when handling 7-Chloro-4-quinolinecarboxylic acid (CAS: 13337-66-1)?

Handling 7-Chloro-4-quinolinecarboxylic acid (CAS: 13337-66-1) requires the use of proper personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...