Compound Q&A

What are the physical and chemical properties of 7-Chloro-4-quinolinecarboxylic acid (CAS: 13337-66-1)?

Answer

7-Chloro-4-quinolinecarboxylic acid
7-Chloro-4-quinolinecarboxylic acid (CAS: 13337-66-1) is a crystalline solid with a molecular weight of approximately 215.65 g/mol. It has a pKa of about 4.7 and is slightly soluble in water. The compound is known for its high reactivity, particularly in electrophilic aromatic substitution reactions.

About

CAS No 13337-66-1
English Name 7-Chloro-4-quinolinecarboxylic acid
Molecular Formula C10H6ClNO2
Molecular Weight 207.62 g/mol
SMILES C1=CC2=C(C=CN=C2C=C1Cl)C(=O)O
InChIKey TXYVRYRRTQYTHJ-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is 7-Chloro-4-quinolinecarboxylic acid (CAS: 13337-66-1) typically synthesized?

7-Chloro-4-quinolinecarboxylic acid is typically synthesized by the chlorination of 4-quinolinecarbo...

Compound Q&A

What industries use 7-Chloro-4-quinolinecarboxylic acid (CAS: 13337-66-1)?

7-Chloro-4-quinolinecarboxylic acid finds applications in the pharmaceutical industry, where it is u...

Compound Q&A

What precautions should be taken when handling 7-Chloro-4-quinolinecarboxylic acid (CAS: 13337-66-1)?

Handling 7-Chloro-4-quinolinecarboxylic acid (CAS: 13337-66-1) requires the use of proper personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...