Compound Q&A

What industries use Tert-butyl 4-bromo-2-methylbenzoate (CAS: 445003-37-2)?

Answer

Tert-butyl 4-bromo-2-methylbenzoate
Tert-butyl 4-bromo-2-methylbenzoate is used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also applied in the polymer industry for the modification of polymer properties. Additionally, it has potential uses in the manufacturing of sensors and semiconductors, although its application in these areas is less common compared to the pharmaceutical and polymer industries.

About

English Name Tert-butyl 4-bromo-2-methylbenzoate
Molecular Formula C12H15BrO2
Molecular Weight 271.15 g/mol
SMILES CC1=C(C=CC(=C1)Br)C(=O)OC(C)(C)C
InChIKey KKSOKTQAWHCIMG-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 4-bromo-2-methylbenzoate (CAS: 445003-37-2)?

Tert-butyl 4-bromo-2-methylbenzoate is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is Tert-butyl 4-bromo-2-methylbenzoate (CAS: 445003-37-2) typically synthesized?

Tert-butyl 4-bromo-2-methylbenzoate is typically synthesized through a bromination reaction of 2-met...

Compound Q&A

What precautions should be taken when handling Tert-butyl 4-bromo-2-methylbenzoate (CAS: 445003-37-2)?

When handling Tert-butyl 4-bromo-2-methylbenzoate, it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...