Compound Q&A

What are the physical and chemical properties of Tert-butyl 4-bromo-2-methylbenzoate (CAS: 445003-37-2)?

Answer

Tert-butyl 4-bromo-2-methylbenzoate
Tert-butyl 4-bromo-2-methylbenzoate is a crystalline compound with a molecular weight of approximately 296.13 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. The compound is moderately reactive and can undergo substitution reactions, particularly with nucleophiles. It can be stored at room temperature but should be protected from moisture and light.

About

English Name Tert-butyl 4-bromo-2-methylbenzoate
Molecular Formula C12H15BrO2
Molecular Weight 271.15 g/mol
SMILES CC1=C(C=CC(=C1)Br)C(=O)OC(C)(C)C
InChIKey KKSOKTQAWHCIMG-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is Tert-butyl 4-bromo-2-methylbenzoate (CAS: 445003-37-2) typically synthesized?

Tert-butyl 4-bromo-2-methylbenzoate is typically synthesized through a bromination reaction of 2-met...

Compound Q&A

What industries use Tert-butyl 4-bromo-2-methylbenzoate (CAS: 445003-37-2)?

Tert-butyl 4-bromo-2-methylbenzoate is used in the pharmaceutical industry as an intermediate in the...

Compound Q&A

What precautions should be taken when handling Tert-butyl 4-bromo-2-methylbenzoate (CAS: 445003-37-2)?

When handling Tert-butyl 4-bromo-2-methylbenzoate, it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...