Compound Q&A

How is Tert-butyl 4-bromo-2-methylbenzoate (CAS: 445003-37-2) typically synthesized?

Answer

Tert-butyl 4-bromo-2-methylbenzoate
Tert-butyl 4-bromo-2-methylbenzoate is typically synthesized through a bromination reaction of 2-methylbenzoic acid with tert-butyl chloride in the presence of a base like sodium hydroxide. The reaction is carried out in an organic solvent such as acetonitrile. The product is isolated by filtration and recrystallization, yielding a high purity compound with a yield of approximately 80-85%.

About

English Name Tert-butyl 4-bromo-2-methylbenzoate
Molecular Formula C12H15BrO2
Molecular Weight 271.15 g/mol
SMILES CC1=C(C=CC(=C1)Br)C(=O)OC(C)(C)C
InChIKey KKSOKTQAWHCIMG-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 4-bromo-2-methylbenzoate (CAS: 445003-37-2)?

Tert-butyl 4-bromo-2-methylbenzoate is a crystalline compound with a molecular weight of approximate...

Compound Q&A

What industries use Tert-butyl 4-bromo-2-methylbenzoate (CAS: 445003-37-2)?

Tert-butyl 4-bromo-2-methylbenzoate is used in the pharmaceutical industry as an intermediate in the...

Compound Q&A

What precautions should be taken when handling Tert-butyl 4-bromo-2-methylbenzoate (CAS: 445003-37-2)?

When handling Tert-butyl 4-bromo-2-methylbenzoate, it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...