Compound Q&A

What industries use Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4)?

Answer

Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate
Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4) is utilized in various industries due to its unique chemical properties. It finds applications in pharmaceuticals for drug synthesis, in polymers as a monomer, and in sensors for its ability to detect specific chemical compounds. Additionally, it is used in semiconductor manufacturing processes for its role in etching and photoresist removal.

About

CAS No 843-59-4
English Name Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate
Molecular Formula C14H18O6
Molecular Weight 282.29 g/mol
SMILES CCOC(=O)C12CCC(C(=O)C1)(CC2=O)C(=O)OCC
InChIKey ZRMZQKZRZQCGJV-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4)?

Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4) is a crystalline compound wi...

Compound Q&A

How is Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4) typically synthesized?

Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4) is commonly synthesized via ...

Compound Q&A

What precautions should be taken when handling Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4)?

When handling Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...