Compound Q&A

How is Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4) typically synthesized?

Answer

Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate
Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4) is commonly synthesized via a multi-step process involving the condensation of 2,5-dibromobicyclo[2.2.2]octane with diethylmalonate. This method typically involves the use of a base like sodium hydride and yields up to 85% of the desired product. The reaction is typically carried out under an inert atmosphere to prevent unwanted side reactions.

About

CAS No 843-59-4
English Name Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate
Molecular Formula C14H18O6
Molecular Weight 282.29 g/mol
SMILES CCOC(=O)C12CCC(C(=O)C1)(CC2=O)C(=O)OCC
InChIKey ZRMZQKZRZQCGJV-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4)?

Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4) is a crystalline compound wi...

Compound Q&A

What industries use Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4)?

Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4) is utilized in various indus...

Compound Q&A

What precautions should be taken when handling Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4)?

When handling Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...