Compound Q&A

What are the physical and chemical properties of Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4)?

Answer

Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate
Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4) is a crystalline compound with a molecular weight of approximately 274.4 g/mol. It has a high solubility in organic solvents like dichloromethane and acetone but is sparingly soluble in water. This compound is known for its reactivity, particularly in esterification reactions and can form hydrogen bonds due to its cyclic structure.

About

CAS No 843-59-4
English Name Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate
Molecular Formula C14H18O6
Molecular Weight 282.29 g/mol
SMILES CCOC(=O)C12CCC(C(=O)C1)(CC2=O)C(=O)OCC
InChIKey ZRMZQKZRZQCGJV-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4) typically synthesized?

Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4) is commonly synthesized via ...

Compound Q&A

What industries use Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4)?

Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4) is utilized in various indus...

Compound Q&A

What precautions should be taken when handling Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4)?

When handling Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 843-59-4), it is essenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...