Compound Q&A

What precautions should be taken when handling 6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8)?

Answer

6-Chloro-2-quinolinecarboxylic acid
When handling 6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a closed container away from heat and ignition sources. Spills should be cleaned up using appropriate safety measures, and the area should be well-ventilated. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions.

About

CAS No 59394-30-8
English Name 6-Chloro-2-quinolinecarboxylic acid
Molecular Formula C10H6ClNO2
Molecular Weight 207.62 g/mol
SMILES C1=CC2=C(C=CC(=N2)C(=O)O)C=C1Cl
InChIKey UKMWQYNJAVNCOZ-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8)?

6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8) is a crystalline solid with a molecular weight...

Compound Q&A

How is 6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8) typically synthesized?

6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8) is typically synthesized via the condensation ...

Compound Q&A

What industries use 6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8)?

6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8) is used in the pharmaceutical industry as a pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...