Compound Q&A

What industries use 6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8)?

Answer

6-Chloro-2-quinolinecarboxylic acid
6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8) is used in the pharmaceutical industry as a precursor for the synthesis of certain bioactive compounds. It also finds applications in the development of sensors due to its reactivity and can be used in the production of semiconductors for its electronic properties.

About

CAS No 59394-30-8
English Name 6-Chloro-2-quinolinecarboxylic acid
Molecular Formula C10H6ClNO2
Molecular Weight 207.62 g/mol
SMILES C1=CC2=C(C=CC(=N2)C(=O)O)C=C1Cl
InChIKey UKMWQYNJAVNCOZ-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8)?

6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8) is a crystalline solid with a molecular weight...

Compound Q&A

How is 6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8) typically synthesized?

6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8) is typically synthesized via the condensation ...

Compound Q&A

What precautions should be taken when handling 6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8)?

When handling 6-Chloro-2-quinolinecarboxylic acid (CAS: 59394-30-8), it is essential to use appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...