Compound Q&A

What industries use 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) (CAS: 131467-87-3)?

Answer

4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1)
4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) is primarily used in the pharmaceutical industry for the synthesis of certain drugs and intermediates. It is also utilized in the polymer industry for the modification of polymer properties and in the development of sensors for detecting specific chemical compounds. Additionally, it has some applications in the electronics industry where it is used as a precursor for semiconductor materials.

About

English Name 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1)
Molecular Formula C6H9N7O3
Molecular Weight 227.18 g/mol
SMILES c1cc(c2c(c1NN)non2)[N+](=O)[O-].NN
InChIKey BLIOAKMSUDUCKB-UHFFFAOYSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) (CAS: 131467-87-3)?

4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) is a crystalline solid with a molecular w...

Compound Q&A

How is 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) (CAS: 131467-87-3) typically synthesized?

4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) is typically synthesized through a multi-...

Compound Q&A

What precautions should be taken when handling 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) (CAS: 131467-87-3)?

When handling 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1), it is essential to use pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...