Compound Q&A

What are the physical and chemical properties of 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) (CAS: 131467-87-3)?

Answer

4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1)
4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) is a crystalline solid with a molecular weight of approximately 302.11 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, particularly in its nitro group and hydrazine moiety, which can participate in various chemical reactions such as nitration, reduction, and substitution.

About

English Name 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1)
Molecular Formula C6H9N7O3
Molecular Weight 227.18 g/mol
SMILES c1cc(c2c(c1NN)non2)[N+](=O)[O-].NN
InChIKey BLIOAKMSUDUCKB-UHFFFAOYSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

How is 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) (CAS: 131467-87-3) typically synthesized?

4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) is typically synthesized through a multi-...

Compound Q&A

What industries use 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) (CAS: 131467-87-3)?

4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) (CAS: 131467-87-3)?

When handling 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1), it is essential to use pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...