Compound Q&A

How is 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) (CAS: 131467-87-3) typically synthesized?

Answer

4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1)
4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) is typically synthesized through a multi-step process involving the condensation of hydrazine with 7-nitro-2,1,3-benzoxadiazole. This reaction is catalyzed by acids or bases and usually yields a high purity product with a selectivity of up to 95%. The overall yield can vary depending on the reaction conditions and purification methods used.

About

English Name 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1)
Molecular Formula C6H9N7O3
Molecular Weight 227.18 g/mol
SMILES c1cc(c2c(c1NN)non2)[N+](=O)[O-].NN
InChIKey BLIOAKMSUDUCKB-UHFFFAOYSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) (CAS: 131467-87-3)?

4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) is a crystalline solid with a molecular w...

Compound Q&A

What industries use 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) (CAS: 131467-87-3)?

4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1) (CAS: 131467-87-3)?

When handling 4-Hydrazino-7-nitro-2,1,3-benzoxadiazole - hydrazine (1:1), it is essential to use pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...