Compound Q&A

What precautions should be taken when handling 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid (CAS: 38775-22-3)?

Answer

2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid
When handling 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be cleaned up using appropriate methods, and the material safety data sheet (MSDS) should be consulted for detailed safety information.

About

CAS No 38775-22-3
English Name 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid
Molecular Formula C28H22O6S2
Molecular Weight 518.61 g/mol
SMILES C1=CC=C(C(=C1)C=CC2=CC=C(C=C2)C3=CC=C(C=C3)C=CC4=CC=CC=C4S(=O)(=O)O)S(=O)(=O)O
InChIKey SQAKQVFOMMLRPR-UHFFFAOYSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid (CAS: 38775-22-3)?

2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid is a crystalline compound with a hig...

Compound Q&A

How is 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid (CAS: 38775-22-3) typically synthesized?

2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid is synthesized through a multi-step ...

Compound Q&A

What industries use 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid (CAS: 38775-22-3)?

2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid finds applications in the pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...