Compound Q&A

What are the physical and chemical properties of 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid (CAS: 38775-22-3)?

Answer

2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid
2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid is a crystalline compound with a high molecular weight and poor water solubility. It exhibits moderate reactivity under certain conditions, particularly in acidic environments. This compound features a complex structure with multiple functional groups, which contribute to its unique chemical properties.

About

CAS No 38775-22-3
English Name 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid
Molecular Formula C28H22O6S2
Molecular Weight 518.61 g/mol
SMILES C1=CC=C(C(=C1)C=CC2=CC=C(C=C2)C3=CC=C(C=C3)C=CC4=CC=CC=C4S(=O)(=O)O)S(=O)(=O)O
InChIKey SQAKQVFOMMLRPR-UHFFFAOYSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

How is 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid (CAS: 38775-22-3) typically synthesized?

2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid is synthesized through a multi-step ...

Compound Q&A

What industries use 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid (CAS: 38775-22-3)?

2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid finds applications in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid (CAS: 38775-22-3)?

When handling 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid, it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...