Compound Q&A

What industries use 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid (CAS: 38775-22-3)?

Answer

2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid
2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid finds applications in the pharmaceutical industry for its potential use in drug synthesis, in the polymer industry for enhancing material properties, and in the semiconductor industry for its use in dielectric materials. Its unique chemical structure also makes it suitable for sensor applications.

About

CAS No 38775-22-3
English Name 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid
Molecular Formula C28H22O6S2
Molecular Weight 518.61 g/mol
SMILES C1=CC=C(C(=C1)C=CC2=CC=C(C=C2)C3=CC=C(C=C3)C=CC4=CC=CC=C4S(=O)(=O)O)S(=O)(=O)O
InChIKey SQAKQVFOMMLRPR-UHFFFAOYSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid (CAS: 38775-22-3)?

2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid is a crystalline compound with a hig...

Compound Q&A

How is 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid (CAS: 38775-22-3) typically synthesized?

2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid is synthesized through a multi-step ...

Compound Q&A

What precautions should be taken when handling 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid (CAS: 38775-22-3)?

When handling 2,2'-(4,4'-Biphenyldiyldi-2,1-ethenediyl)dibenzenesulfonic acid, it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...