Compound Q&A

What are the physical and chemical properties of Tetramethylrhodamine-5-isothiocyanate (CAS: 80724-19-2)?

Answer

Tetramethylrhodamine-5-isothiocyanate
Tetramethylrhodamine-5-isothiocyanate (CAS: 80724-19-2) is a yellow crystalline solid with a molecular weight of approximately 378.42 g/mol. It has poor water solubility but is soluble in organic solvents such as DMF, DMSO, and acetonitrile. It exhibits good fluorescence properties and is reactive towards amino groups, making it useful for conjugation with proteins and other biomolecules.

About

CAS No 80724-19-2
English Name Tetramethylrhodamine-5-isothiocyanate
Molecular Formula C25H21N3O3S
Molecular Weight 443.52 g/mol
SMILES CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=C(C=C4)N=C=S)C(=O)[O-]
InChIKey IJSMFQNTEUNRPY-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is Tetramethylrhodamine-5-isothiocyanate (CAS: 80724-19-2) typically synthesized?

Tetramethylrhodamine-5-isothiocyanate is typically synthesized by reacting tetramethylrhodamine with...

Compound Q&A

What industries use Tetramethylrhodamine-5-isothiocyanate (CAS: 80724-19-2)?

Tetramethylrhodamine-5-isothiocyanate (CAS: 80724-19-2) is widely used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Tetramethylrhodamine-5-isothiocyanate (CAS: 80724-19-2)?

When handling Tetramethylrhodamine-5-isothiocyanate (CAS: 80724-19-2), always wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...