Compound Q&A

What precautions should be taken when handling ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid (CAS: 910231-21-9)?

Answer

((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid
When handling ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid, it is important to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up carefully, and proper safety data sheets (SDS) should be consulted for detailed handling instructions. The compound should be stored in a cool, dry place away from strong acids and bases.

About

English Name ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid
Molecular Formula C21H18B3N3O6
Molecular Weight 440.83 g/mol
SMILES B(C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)B(O)O)C4=CC=C(C=C4)B(O)O)(O)O
InChIKey IFDYUPUXDOYIOW-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid (CAS: 910231-21-9)?

((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid is a crystalline solid with a mo...

Compound Q&A

How is ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid (CAS: 910231-21-9) typically synthesized?

((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid is typically synthesized through...

Compound Q&A

What industries use ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid (CAS: 910231-21-9)?

((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))triboronic acid finds applications in the pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...